C11H13FN2O4 — CID 107350606
(3S,4R)-1-[(2-fluoro-3-nitrophenyl)methyl]pyrrolidine-3,4-diol (PubChem CID 107350606) has the molecular formula C11H13FN2O4 and a molecular weight of 256.23 g/mol. Its IUPAC name is (3S,4R)-1-[(2-fluoro-3-nitrophenyl)methyl]pyrrolidine-3,4-diol.
| Compound Name | (3S,4R)-1-[(2-fluoro-3-nitrophenyl)methyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 107350606 |
| Molecular Formula | C11H13FN2O4 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | (3S,4R)-1-[(2-fluoro-3-nitrophenyl)methyl]pyrrolidine-3,4-diol |
| SMILES | O=[N+]([O-])c1cccc(CN2C[C@@H](O)[C@@H](O)C2)c1F |
| InChI | InChI=1S/C11H13FN2O4/c12-11-7(2-1-3-8(11)14(17)18)4-13-5-9(15)10(16)6-13/h1-3,9-10,15-16H,4-6H2/t9-,10+ |
| InChIKey | OQXZFZZTTJESPT-AOOOYVTPSA-N |
| XLogP | 0.27 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|