C13H14BrF4N — CID 165413623
1-[(2-bromo-6-fluorophenyl)methyl]-3-(trifluoromethyl)piperidine (PubChem CID 165413623) has the molecular formula C13H14BrF4N and a molecular weight of 340.16 g/mol. Its IUPAC name is 1-[(2-bromo-6-fluorophenyl)methyl]-3-(trifluoromethyl)piperidine.
| Compound Name | 1-[(2-bromo-6-fluorophenyl)methyl]-3-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 165413623 |
| Molecular Formula | C13H14BrF4N |
| Molecular Weight | 340.16 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 1-[(2-bromo-6-fluorophenyl)methyl]-3-(trifluoromethyl)piperidine |
| SMILES | Fc1cccc(Br)c1CN1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H14BrF4N/c14-11-4-1-5-12(15)10(11)8-19-6-2-3-9(7-19)13(16,17)18/h1,4-5,9H,2-3,6-8H2 |
| InChIKey | RUKPHSXSRBNQOQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.16 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |