C13H16BrFN2 — CID 120846044
(3aS,6aR)-5-[(2-bromo-6-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 120846044) has the molecular formula C13H16BrFN2 and a molecular weight of 299.19 g/mol. Its IUPAC name is (3aS,6aR)-5-[(2-bromo-6-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | (3aS,6aR)-5-[(2-bromo-6-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 120846044 |
| Molecular Formula | C13H16BrFN2 |
| Molecular Weight | 299.19 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | (3aS,6aR)-5-[(2-bromo-6-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | Fc1cccc(Br)c1CN1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C13H16BrFN2/c14-12-2-1-3-13(15)11(12)8-17-6-9-4-16-5-10(9)7-17/h1-3,9-10,16H,4-8H2/t9-,10+ |
| InChIKey | SMONTIHHURURFF-AOOOYVTPSA-N |
| XLogP | 2.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.19 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |