C14H18ClFN2 — CID 113346138
(4aS,7aS)-6-[(2-chloro-6-fluorophenyl)methyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 113346138) has the molecular formula C14H18ClFN2 and a molecular weight of 268.76 g/mol. Its IUPAC name is (4aS,7aS)-6-[(2-chloro-6-fluorophenyl)methyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | (4aS,7aS)-6-[(2-chloro-6-fluorophenyl)methyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 113346138 |
| Molecular Formula | C14H18ClFN2 |
| Molecular Weight | 268.76 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (4aS,7aS)-6-[(2-chloro-6-fluorophenyl)methyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | Fc1cccc(Cl)c1CN1C[C@@H]2CCCN[C@@H]2C1 |
| InChI | InChI=1S/C14H18ClFN2/c15-12-4-1-5-13(16)11(12)8-18-7-10-3-2-6-17-14(10)9-18/h1,4-5,10,14,17H,2-3,6-9H2/t10-,14+/m0/s1 |
| InChIKey | OLNIITAVYYWFAL-IINYFYTJSA-N |
| XLogP | 2.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.76 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |