C21H25FN2O — CID 138042170
(4aS,7aS)-6-[[4-[(2-fluorophenyl)methoxy]phenyl]methyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 138042170) has the molecular formula C21H25FN2O and a molecular weight of 340.44 g/mol. Its IUPAC name is (4aS,7aS)-6-[[4-[(2-fluorophenyl)methoxy]phenyl]methyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | (4aS,7aS)-6-[[4-[(2-fluorophenyl)methoxy]phenyl]methyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 138042170 |
| Molecular Formula | C21H25FN2O |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (4aS,7aS)-6-[[4-[(2-fluorophenyl)methoxy]phenyl]methyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | Fc1ccccc1COc1ccc(CN2C[C@@H]3CCCN[C@@H]3C2)cc1 |
| InChI | InChI=1S/C21H25FN2O/c22-20-6-2-1-4-18(20)15-25-19-9-7-16(8-10-19)12-24-13-17-5-3-11-23-21(17)14-24/h1-2,4,6-10,17,21,23H,3,5,11-15H2/t17-,21+/m0/s1 |
| InChIKey | JEYOLWNGXBNUQG-LAUBAEHRSA-N |
| XLogP | 3.59 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |