C14H17F3N2 — CID 103887159
(4aS,7aS)-6-[(2,4,5-trifluorophenyl)methyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 103887159) has the molecular formula C14H17F3N2 and a molecular weight of 270.30 g/mol. Its IUPAC name is (4aS,7aS)-6-[(2,4,5-trifluorophenyl)methyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | (4aS,7aS)-6-[(2,4,5-trifluorophenyl)methyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 103887159 |
| Molecular Formula | C14H17F3N2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (4aS,7aS)-6-[(2,4,5-trifluorophenyl)methyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | Fc1cc(F)c(CN2C[C@@H]3CCCN[C@@H]3C2)cc1F |
| InChI | InChI=1S/C14H17F3N2/c15-11-5-13(17)12(16)4-10(11)7-19-6-9-2-1-3-18-14(9)8-19/h4-5,9,14,18H,1-3,6-8H2/t9-,14+/m0/s1 |
| InChIKey | ZVFGEYWNOKRPKS-LKFCYVNXSA-N |
| XLogP | 2.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|