C15H18F4N2 — CID 103887190
(4aS,7aS)-6-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 103887190) has the molecular formula C15H18F4N2 and a molecular weight of 302.31 g/mol. Its IUPAC name is (4aS,7aS)-6-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | (4aS,7aS)-6-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 103887190 |
| Molecular Formula | C15H18F4N2 |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (4aS,7aS)-6-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | Fc1ccc(CN2C[C@@H]3CCCN[C@@H]3C2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H18F4N2/c16-12-4-3-10(13(6-12)15(17,18)19)7-21-8-11-2-1-5-20-14(11)9-21/h3-4,6,11,14,20H,1-2,5,7-9H2/t11-,14+/m0/s1 |
| InChIKey | VIRSUJQAFGXJBY-SMDDNHRTSA-N |
| XLogP | 3.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |