C15H20F2N2 — CID 64869739
3-cyclopropyl-1-[(2,4-difluorophenyl)methyl]-1,4-diazepane (PubChem CID 64869739) has the molecular formula C15H20F2N2 and a molecular weight of 266.33 g/mol. Its IUPAC name is 3-cyclopropyl-1-[(2,4-difluorophenyl)methyl]-1,4-diazepane.
| Compound Name | 3-cyclopropyl-1-[(2,4-difluorophenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 64869739 |
| Molecular Formula | C15H20F2N2 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 3-cyclopropyl-1-[(2,4-difluorophenyl)methyl]-1,4-diazepane |
| SMILES | Fc1ccc(CN2CCCNC(C3CC3)C2)c(F)c1 |
| InChI | InChI=1S/C15H20F2N2/c16-13-5-4-12(14(17)8-13)9-19-7-1-6-18-15(10-19)11-2-3-11/h4-5,8,11,15,18H,1-3,6-7,9-10H2 |
| InChIKey | WBMGTBAPCMKMEE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |