C14H18F2N2 — CID 64833211
3-cyclopropyl-1-[(2,5-difluorophenyl)methyl]piperazine (PubChem CID 64833211) has the molecular formula C14H18F2N2 and a molecular weight of 252.31 g/mol. Its IUPAC name is 3-cyclopropyl-1-[(2,5-difluorophenyl)methyl]piperazine.
| Compound Name | 3-cyclopropyl-1-[(2,5-difluorophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 64833211 |
| Molecular Formula | C14H18F2N2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 3-cyclopropyl-1-[(2,5-difluorophenyl)methyl]piperazine |
| SMILES | Fc1ccc(F)c(CN2CCNC(C3CC3)C2)c1 |
| InChI | InChI=1S/C14H18F2N2/c15-12-3-4-13(16)11(7-12)8-18-6-5-17-14(9-18)10-1-2-10/h3-4,7,10,14,17H,1-2,5-6,8-9H2 |
| InChIKey | XLPOYRHFPIDLPD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |