C12H14ClF2N — CID 63386784
3-chloro-1-[(2,5-difluorophenyl)methyl]piperidine (PubChem CID 63386784) has the molecular formula C12H14ClF2N and a molecular weight of 245.70 g/mol. Its IUPAC name is 3-chloro-1-[(2,5-difluorophenyl)methyl]piperidine.
| Compound Name | 3-chloro-1-[(2,5-difluorophenyl)methyl]piperidine |
|---|---|
| PubChem CID | 63386784 |
| Molecular Formula | C12H14ClF2N |
| Molecular Weight | 245.70 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 3-chloro-1-[(2,5-difluorophenyl)methyl]piperidine |
| SMILES | Fc1ccc(F)c(CN2CCCC(Cl)C2)c1 |
| InChI | InChI=1S/C12H14ClF2N/c13-10-2-1-5-16(8-10)7-9-6-11(14)3-4-12(9)15/h3-4,6,10H,1-2,5,7-8H2 |
| InChIKey | UJOPJCRSYIUTND-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.70 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|