C17H24ClFN2 — CID 64953574
1-[(3-chloro-4-fluorophenyl)methyl]-3-cyclohexylpiperazine (PubChem CID 64953574) has the molecular formula C17H24ClFN2 and a molecular weight of 310.84 g/mol. Its IUPAC name is 1-[(3-chloro-4-fluorophenyl)methyl]-3-cyclohexylpiperazine.
| Compound Name | 1-[(3-chloro-4-fluorophenyl)methyl]-3-cyclohexylpiperazine |
|---|---|
| PubChem CID | 64953574 |
| Molecular Formula | C17H24ClFN2 |
| Molecular Weight | 310.84 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 1-[(3-chloro-4-fluorophenyl)methyl]-3-cyclohexylpiperazine |
| SMILES | Fc1ccc(CN2CCNC(C3CCCCC3)C2)cc1Cl |
| InChI | InChI=1S/C17H24ClFN2/c18-15-10-13(6-7-16(15)19)11-21-9-8-20-17(12-21)14-4-2-1-3-5-14/h6-7,10,14,17,20H,1-5,8-9,11-12H2 |
| InChIKey | NWDMHGKUHXKFFL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.84 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |