C13H16ClFN2 — CID 124783736
(3aS,6aS)-5-[(4-chloro-3-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole (PubChem CID 124783736) has the molecular formula C13H16ClFN2 and a molecular weight of 254.74 g/mol. Its IUPAC name is (3aS,6aS)-5-[(4-chloro-3-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole.
| Compound Name | (3aS,6aS)-5-[(4-chloro-3-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 124783736 |
| Molecular Formula | C13H16ClFN2 |
| Molecular Weight | 254.74 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | (3aS,6aS)-5-[(4-chloro-3-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole |
| SMILES | Fc1cc(CN2C[C@@H]3CCN[C@@H]3C2)ccc1Cl |
| InChI | InChI=1S/C13H16ClFN2/c14-11-2-1-9(5-12(11)15)6-17-7-10-3-4-16-13(10)8-17/h1-2,5,10,13,16H,3-4,6-8H2/t10-,13+/m0/s1 |
| InChIKey | SQHWCZWLQJVRAN-GXFFZTMASA-N |
| XLogP | 2.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.74 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |