C15H21FN2 — CID 64870330
3-cyclopropyl-1-[(4-fluorophenyl)methyl]-1,4-diazepane (PubChem CID 64870330) has the molecular formula C15H21FN2 and a molecular weight of 248.34 g/mol. Its IUPAC name is 3-cyclopropyl-1-[(4-fluorophenyl)methyl]-1,4-diazepane.
| Compound Name | 3-cyclopropyl-1-[(4-fluorophenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 64870330 |
| Molecular Formula | C15H21FN2 |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 3-cyclopropyl-1-[(4-fluorophenyl)methyl]-1,4-diazepane |
| SMILES | Fc1ccc(CN2CCCNC(C3CC3)C2)cc1 |
| InChI | InChI=1S/C15H21FN2/c16-14-6-2-12(3-7-14)10-18-9-1-8-17-15(11-18)13-4-5-13/h2-3,6-7,13,15,17H,1,4-5,8-11H2 |
| InChIKey | TUQBYVDRSMEVQB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |