C15H20ClFN2 — CID 146040171
(4aR,8aS)-6-[(2-chloro-6-fluorophenyl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine (PubChem CID 146040171) has the molecular formula C15H20ClFN2 and a molecular weight of 282.79 g/mol. Its IUPAC name is (4aR,8aS)-6-[(2-chloro-6-fluorophenyl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine.
| Compound Name | (4aR,8aS)-6-[(2-chloro-6-fluorophenyl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine |
|---|---|
| PubChem CID | 146040171 |
| Molecular Formula | C15H20ClFN2 |
| Molecular Weight | 282.79 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (4aR,8aS)-6-[(2-chloro-6-fluorophenyl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine |
| SMILES | Fc1cccc(Cl)c1CN1CC[C@@H]2NCCC[C@@H]2C1 |
| InChI | InChI=1S/C15H20ClFN2/c16-13-4-1-5-14(17)12(13)10-19-8-6-15-11(9-19)3-2-7-18-15/h1,4-5,11,15,18H,2-3,6-10H2/t11-,15+/m1/s1 |
| InChIKey | XSEOHNZFPOGDOP-ABAIWWIYSA-N |
| XLogP | 3.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.79 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |