C15H22ClFN2 — CID 64870681
1-[(2-chloro-6-fluorophenyl)methyl]-3-propyl-1,4-diazepane (PubChem CID 64870681) has the molecular formula C15H22ClFN2 and a molecular weight of 284.81 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-3-propyl-1,4-diazepane.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-3-propyl-1,4-diazepane |
|---|---|
| PubChem CID | 64870681 |
| Molecular Formula | C15H22ClFN2 |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-3-propyl-1,4-diazepane |
| SMILES | CCCC1CN(Cc2c(F)cccc2Cl)CCCN1 |
| InChI | InChI=1S/C15H22ClFN2/c1-2-5-12-10-19(9-4-8-18-12)11-13-14(16)6-3-7-15(13)17/h3,6-7,12,18H,2,4-5,8-11H2,1H3 |
| InChIKey | XUDVICPPZCCZMB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |