C17H17BrF3NO — CID 27081266
6-bromo-1-[[(3S)-3-(trifluoromethyl)piperidin-1-yl]methyl]naphthalen-2-ol (PubChem CID 27081266) has the molecular formula C17H17BrF3NO and a molecular weight of 388.23 g/mol. Its IUPAC name is 6-bromo-1-[[(3S)-3-(trifluoromethyl)piperidin-1-yl]methyl]naphthalen-2-ol.
| Compound Name | 6-bromo-1-[[(3S)-3-(trifluoromethyl)piperidin-1-yl]methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 27081266 |
| Molecular Formula | C17H17BrF3NO |
| Molecular Weight | 388.23 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 6-bromo-1-[[(3S)-3-(trifluoromethyl)piperidin-1-yl]methyl]naphthalen-2-ol |
| SMILES | Oc1ccc2cc(Br)ccc2c1CN1CCC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C17H17BrF3NO/c18-13-4-5-14-11(8-13)3-6-16(23)15(14)10-22-7-1-2-12(9-22)17(19,20)21/h3-6,8,12,23H,1-2,7,9-10H2/t12-/m0/s1 |
| InChIKey | YPAYLTLVZAAMJM-LBPRGKRZSA-N |
| XLogP | 5.08 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.23 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|