C17H22BrF3N2 — CID 170453833
1-[(4-bromo-2-pyrrolidin-1-ylphenyl)methyl]-3-(trifluoromethyl)piperidine (PubChem CID 170453833) has the molecular formula C17H22BrF3N2 and a molecular weight of 391.28 g/mol. Its IUPAC name is 1-[(4-bromo-2-pyrrolidin-1-ylphenyl)methyl]-3-(trifluoromethyl)piperidine.
| Compound Name | 1-[(4-bromo-2-pyrrolidin-1-ylphenyl)methyl]-3-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 170453833 |
| Molecular Formula | C17H22BrF3N2 |
| Molecular Weight | 391.28 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 1-[(4-bromo-2-pyrrolidin-1-ylphenyl)methyl]-3-(trifluoromethyl)piperidine |
| SMILES | FC(F)(F)C1CCCN(Cc2ccc(Br)cc2N2CCCC2)C1 |
| InChI | InChI=1S/C17H22BrF3N2/c18-15-6-5-13(16(10-15)23-8-1-2-9-23)11-22-7-3-4-14(12-22)17(19,20)21/h5-6,10,14H,1-4,7-9,11-12H2 |
| InChIKey | NOPIRTCPEZJOOR-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.28 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |