C15H22BrN3O — CID 120833970
(3R)-1-[(4-bromo-2-morpholin-4-ylphenyl)methyl]pyrrolidin-3-amine (PubChem CID 120833970) has the molecular formula C15H22BrN3O and a molecular weight of 340.27 g/mol. Its IUPAC name is (3R)-1-[(4-bromo-2-morpholin-4-ylphenyl)methyl]pyrrolidin-3-amine.
| Compound Name | (3R)-1-[(4-bromo-2-morpholin-4-ylphenyl)methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 120833970 |
| Molecular Formula | C15H22BrN3O |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (3R)-1-[(4-bromo-2-morpholin-4-ylphenyl)methyl]pyrrolidin-3-amine |
| SMILES | N[C@@H]1CCN(Cc2ccc(Br)cc2N2CCOCC2)C1 |
| InChI | InChI=1S/C15H22BrN3O/c16-13-2-1-12(10-18-4-3-14(17)11-18)15(9-13)19-5-7-20-8-6-19/h1-2,9,14H,3-8,10-11,17H2/t14-/m1/s1 |
| InChIKey | XZBRRMHENMPWON-CQSZACIVSA-N |
| XLogP | 1.82 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |