C16H24BrN3O2 — CID 120844485
[4-[(4-bromo-2-morpholin-4-ylphenyl)methyl]morpholin-2-yl]methanamine (PubChem CID 120844485) has the molecular formula C16H24BrN3O2 and a molecular weight of 370.29 g/mol. Its IUPAC name is [4-[(4-bromo-2-morpholin-4-ylphenyl)methyl]morpholin-2-yl]methanamine.
| Compound Name | [4-[(4-bromo-2-morpholin-4-ylphenyl)methyl]morpholin-2-yl]methanamine |
|---|---|
| PubChem CID | 120844485 |
| Molecular Formula | C16H24BrN3O2 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | [4-[(4-bromo-2-morpholin-4-ylphenyl)methyl]morpholin-2-yl]methanamine |
| SMILES | NCC1CN(Cc2ccc(Br)cc2N2CCOCC2)CCO1 |
| InChI | InChI=1S/C16H24BrN3O2/c17-14-2-1-13(11-19-3-8-22-15(10-18)12-19)16(9-14)20-4-6-21-7-5-20/h1-2,9,15H,3-8,10-12,18H2 |
| InChIKey | IYRQNHYADPPJSL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |