C20H32BrN3 — CID 174836186
1-[(4-bromo-2-piperidin-1-ylphenyl)methyl]-4-(2-methylpropyl)piperazine (PubChem CID 174836186) has the molecular formula C20H32BrN3 and a molecular weight of 394.40 g/mol. Its IUPAC name is 1-[(4-bromo-2-piperidin-1-ylphenyl)methyl]-4-(2-methylpropyl)piperazine.
| Compound Name | 1-[(4-bromo-2-piperidin-1-ylphenyl)methyl]-4-(2-methylpropyl)piperazine |
|---|---|
| PubChem CID | 174836186 |
| Molecular Formula | C20H32BrN3 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 1-[(4-bromo-2-piperidin-1-ylphenyl)methyl]-4-(2-methylpropyl)piperazine |
| SMILES | CC(C)CN1CCN(Cc2ccc(Br)cc2N2CCCCC2)CC1 |
| InChI | InChI=1S/C20H32BrN3/c1-17(2)15-22-10-12-23(13-11-22)16-18-6-7-19(21)14-20(18)24-8-4-3-5-9-24/h6-7,14,17H,3-5,8-13,15-16H2,1-2H3 |
| InChIKey | FBNIINBUYATXMP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |