C13H15F4N — CID 51970058
(3R)-1-[(4-fluorophenyl)methyl]-3-(trifluoromethyl)piperidine (PubChem CID 51970058) has the molecular formula C13H15F4N and a molecular weight of 261.26 g/mol. Its IUPAC name is (3R)-1-[(4-fluorophenyl)methyl]-3-(trifluoromethyl)piperidine.
| Compound Name | (3R)-1-[(4-fluorophenyl)methyl]-3-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 51970058 |
| Molecular Formula | C13H15F4N |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | (3R)-1-[(4-fluorophenyl)methyl]-3-(trifluoromethyl)piperidine |
| SMILES | Fc1ccc(CN2CCC[C@@H](C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C13H15F4N/c14-12-5-3-10(4-6-12)8-18-7-1-2-11(9-18)13(15,16)17/h3-6,11H,1-2,7-9H2/t11-/m1/s1 |
| InChIKey | XAXDMNDPZRTETQ-LLVKDONJSA-N |
| XLogP | 3.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |