C14H16F3NO3 — CID 60650760
1-(3,4-dihydroxyphenyl)-2-[3-(trifluoromethyl)piperidin-1-yl]ethanone (PubChem CID 60650760) has the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-2-[3-(trifluoromethyl)piperidin-1-yl]ethanone.
| Compound Name | 1-(3,4-dihydroxyphenyl)-2-[3-(trifluoromethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 60650760 |
| Molecular Formula | C14H16F3NO3 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-2-[3-(trifluoromethyl)piperidin-1-yl]ethanone |
| SMILES | O=C(CN1CCCC(C(F)(F)F)C1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H16F3NO3/c15-14(16,17)10-2-1-5-18(7-10)8-13(21)9-3-4-11(19)12(20)6-9/h3-4,6,10,19-20H,1-2,5,7-8H2 |
| InChIKey | QWVLSPKPKYLXQN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|