C17H25NO3 — CID 62091109
2-(4-tert-butylpiperidin-1-yl)-1-(3,4-dihydroxyphenyl)ethanone (PubChem CID 62091109) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-(4-tert-butylpiperidin-1-yl)-1-(3,4-dihydroxyphenyl)ethanone.
| Compound Name | 2-(4-tert-butylpiperidin-1-yl)-1-(3,4-dihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 62091109 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-(4-tert-butylpiperidin-1-yl)-1-(3,4-dihydroxyphenyl)ethanone |
| SMILES | CC(C)(C)C1CCN(CC(=O)c2ccc(O)c(O)c2)CC1 |
| InChI | InChI=1S/C17H25NO3/c1-17(2,3)13-6-8-18(9-7-13)11-16(21)12-4-5-14(19)15(20)10-12/h4-5,10,13,19-20H,6-9,11H2,1-3H3 |
| InChIKey | KIOYTFZZHDQVRC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|