C14H22Cl2N2O4 — CID 163483598
1-(3,4-dihydroxyphenyl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanone;dihydrochloride (PubChem CID 163483598) has the molecular formula C14H22Cl2N2O4 and a molecular weight of 353.25 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanone;dihydrochloride.
| Compound Name | 1-(3,4-dihydroxyphenyl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 163483598 |
| Molecular Formula | C14H22Cl2N2O4 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(CN1CCN(CCO)CC1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H20N2O4.2ClH/c17-8-7-15-3-5-16(6-4-15)10-14(20)11-1-2-12(18)13(19)9-11;;/h1-2,9,17-19H,3-8,10H2;2*1H |
| InChIKey | CGQKSBCOXXPXAL-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|