C20H29F3N2O — CID 56915391
N-methyl-N-propan-2-yl-2-[3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidin-1-yl]acetamide (PubChem CID 56915391) has the molecular formula C20H29F3N2O and a molecular weight of 370.46 g/mol. Its IUPAC name is N-methyl-N-propan-2-yl-2-[3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidin-1-yl]acetamide.
| Compound Name | N-methyl-N-propan-2-yl-2-[3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 56915391 |
| Molecular Formula | C20H29F3N2O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | N-methyl-N-propan-2-yl-2-[3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidin-1-yl]acetamide |
| SMILES | CC(C)N(C)C(=O)CN1CCCC(CCc2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C20H29F3N2O/c1-15(2)24(3)19(26)14-25-12-6-7-16(13-25)10-11-17-8-4-5-9-18(17)20(21,22)23/h4-5,8-9,15-16H,6-7,10-14H2,1-3H3 |
| InChIKey | YXOIGVJGPSTGKA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |