C17H23F3N2O — CID 95714573
(3S)-N-ethyl-3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidine-1-carboxamide (PubChem CID 95714573) has the molecular formula C17H23F3N2O and a molecular weight of 328.38 g/mol. Its IUPAC name is (3S)-N-ethyl-3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidine-1-carboxamide.
| Compound Name | (3S)-N-ethyl-3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95714573 |
| Molecular Formula | C17H23F3N2O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | (3S)-N-ethyl-3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidine-1-carboxamide |
| SMILES | CCNC(=O)N1CCC[C@H](CCc2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C17H23F3N2O/c1-2-21-16(23)22-11-5-6-13(12-22)9-10-14-7-3-4-8-15(14)17(18,19)20/h3-4,7-8,13H,2,5-6,9-12H2,1H3,(H,21,23)/t13-/m1/s1 |
| InChIKey | DFDHIZUHLYCZBQ-CYBMUJFWSA-N |
| XLogP | 4.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |