C18H24F3NO — CID 50976131
2-methyl-1-[3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidin-1-yl]propan-1-one (PubChem CID 50976131) has the molecular formula C18H24F3NO and a molecular weight of 327.39 g/mol. Its IUPAC name is 2-methyl-1-[3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidin-1-yl]propan-1-one.
| Compound Name | 2-methyl-1-[3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 50976131 |
| Molecular Formula | C18H24F3NO |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 2-methyl-1-[3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidin-1-yl]propan-1-one |
| SMILES | CC(C)C(=O)N1CCCC(CCc2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C18H24F3NO/c1-13(2)17(23)22-11-5-6-14(12-22)9-10-15-7-3-4-8-16(15)18(19,20)21/h3-4,7-8,13-14H,5-6,9-12H2,1-2H3 |
| InChIKey | HSKPHSQOFYBPHP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |