C17H18F3N3OS — CID 42122916
thiadiazol-4-yl-[(3S)-3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidin-1-yl]methanone (PubChem CID 42122916) has the molecular formula C17H18F3N3OS and a molecular weight of 369.41 g/mol. Its IUPAC name is thiadiazol-4-yl-[(3S)-3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidin-1-yl]methanone.
| Compound Name | thiadiazol-4-yl-[(3S)-3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 42122916 |
| Molecular Formula | C17H18F3N3OS |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | thiadiazol-4-yl-[(3S)-3-[2-[2-(trifluoromethyl)phenyl]ethyl]piperidin-1-yl]methanone |
| SMILES | O=C(c1csnn1)N1CCC[C@H](CCc2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C17H18F3N3OS/c18-17(19,20)14-6-2-1-5-13(14)8-7-12-4-3-9-23(10-12)16(24)15-11-25-22-21-15/h1-2,5-6,11-12H,3-4,7-10H2/t12-/m1/s1 |
| InChIKey | ADZXFQRHNOSNFC-GFCCVEGCSA-N |
| XLogP | 4.04 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |