C19H25ClN2O — CID 108896104
1-(1-adamantyl)-3-[2-(3-chlorophenyl)ethyl]urea (PubChem CID 108896104) has the molecular formula C19H25ClN2O and a molecular weight of 332.87 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[2-(3-chlorophenyl)ethyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[2-(3-chlorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 108896104 |
| Molecular Formula | C19H25ClN2O |
| Molecular Weight | 332.87 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1-(1-adamantyl)-3-[2-(3-chlorophenyl)ethyl]urea |
| SMILES | O=C(NCCc1cccc(Cl)c1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H25ClN2O/c20-17-3-1-2-13(9-17)4-5-21-18(23)22-19-10-14-6-15(11-19)8-16(7-14)12-19/h1-3,9,14-16H,4-8,10-12H2,(H2,21,22,23) |
| InChIKey | PNKHUVKEFKELOO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.87 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |