C19H20Cl2N2O — CID 113214484
1-[[1-(4-chlorophenyl)cyclopropyl]methyl]-3-[2-(3-chlorophenyl)ethyl]urea (PubChem CID 113214484) has the molecular formula C19H20Cl2N2O and a molecular weight of 363.29 g/mol. Its IUPAC name is 1-[[1-(4-chlorophenyl)cyclopropyl]methyl]-3-[2-(3-chlorophenyl)ethyl]urea.
| Compound Name | 1-[[1-(4-chlorophenyl)cyclopropyl]methyl]-3-[2-(3-chlorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 113214484 |
| Molecular Formula | C19H20Cl2N2O |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 1-[[1-(4-chlorophenyl)cyclopropyl]methyl]-3-[2-(3-chlorophenyl)ethyl]urea |
| SMILES | O=C(NCCc1cccc(Cl)c1)NCC1(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H20Cl2N2O/c20-16-6-4-15(5-7-16)19(9-10-19)13-23-18(24)22-11-8-14-2-1-3-17(21)12-14/h1-7,12H,8-11,13H2,(H2,22,23,24) |
| InChIKey | FMBJFVABHGNJJO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |