C16H21ClN2O2 — CID 111618958
1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-3-[[1-(hydroxymethyl)cyclopropyl]methyl]urea (PubChem CID 111618958) has the molecular formula C16H21ClN2O2 and a molecular weight of 308.81 g/mol. Its IUPAC name is 1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-3-[[1-(hydroxymethyl)cyclopropyl]methyl]urea.
| Compound Name | 1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-3-[[1-(hydroxymethyl)cyclopropyl]methyl]urea |
|---|---|
| PubChem CID | 111618958 |
| Molecular Formula | C16H21ClN2O2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-3-[[1-(hydroxymethyl)cyclopropyl]methyl]urea |
| SMILES | O=C(NCC1(CO)CC1)NCC1(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C16H21ClN2O2/c17-13-3-1-2-12(8-13)16(6-7-16)10-19-14(21)18-9-15(11-20)4-5-15/h1-3,8,20H,4-7,9-11H2,(H2,18,19,21) |
| InChIKey | UVMAELDAMPZDJT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |