C15H14ClNO2 — CID 110443400
N-[[1-(3-chlorophenyl)cyclopropyl]methyl]furan-2-carboxamide (PubChem CID 110443400) has the molecular formula C15H14ClNO2 and a molecular weight of 275.74 g/mol. Its IUPAC name is N-[[1-(3-chlorophenyl)cyclopropyl]methyl]furan-2-carboxamide.
| Compound Name | N-[[1-(3-chlorophenyl)cyclopropyl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 110443400 |
| Molecular Formula | C15H14ClNO2 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | N-[[1-(3-chlorophenyl)cyclopropyl]methyl]furan-2-carboxamide |
| SMILES | O=C(NCC1(c2cccc(Cl)c2)CC1)c1ccco1 |
| InChI | InChI=1S/C15H14ClNO2/c16-12-4-1-3-11(9-12)15(6-7-15)10-17-14(18)13-5-2-8-19-13/h1-5,8-9H,6-7,10H2,(H,17,18) |
| InChIKey | OGUPBPIEIACNBU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |