C20H28N2OS — CID 3250585
1-(1-adamantyl)-3-[2-(3-methoxyphenyl)ethyl]thiourea (PubChem CID 3250585) has the molecular formula C20H28N2OS and a molecular weight of 344.52 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[2-(3-methoxyphenyl)ethyl]thiourea.
| Compound Name | 1-(1-adamantyl)-3-[2-(3-methoxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 3250585 |
| Molecular Formula | C20H28N2OS |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 1-(1-adamantyl)-3-[2-(3-methoxyphenyl)ethyl]thiourea |
| SMILES | COc1cccc(CCNC(=S)NC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C20H28N2OS/c1-23-18-4-2-3-14(10-18)5-6-21-19(24)22-20-11-15-7-16(12-20)9-17(8-15)13-20/h2-4,10,15-17H,5-9,11-13H2,1H3,(H2,21,22,24) |
| InChIKey | TWYBWXOHXLLEAZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|