(2S)-2-decyl-2,3-dihydro-1H-indole-6-carboxylic acid

C19H29NO2 — CID 70486702

IUPAC(2S)-2-decyl-2,3-dihydro-1H-indole-6-carboxylic acid
SMILESCCCCCCCCCC[C@H]1Cc2ccc(C(=O)O)cc2N1
InChIInChI=1S/C19H29NO2/c1-2-3-4-5-6-7-8-9-10-17-13-15-11-12-16(19(21)22)14-18(15)20-17/h11-12,14,17,20H,2-10,13H2,1H3,(H,21,22)/t17-/m0/s1
InChIKeyNGUQPIGUWYHNFP-KRWDZBQOSA-N
MW303.45 g/mol
LogP5.25
Rot. Bonds10

About (2S)-2-decyl-2,3-dihydro-1H-indole-6-carboxylic acid

(2S)-2-decyl-2,3-dihydro-1H-indole-6-carboxylic acid (PubChem CID 70486702) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is (2S)-2-decyl-2,3-dihydro-1H-indole-6-carboxylic acid.

Molecular Properties

Compound Name(2S)-2-decyl-2,3-dihydro-1H-indole-6-carboxylic acid
PubChem CID70486702
Molecular FormulaC19H29NO2
Molecular Weight303.45 g/mol
Exact Mass303.22
IUPAC Name(2S)-2-decyl-2,3-dihydro-1H-indole-6-carboxylic acid
SMILESCCCCCCCCCC[C@H]1Cc2ccc(C(=O)O)cc2N1
InChIInChI=1S/C19H29NO2/c1-2-3-4-5-6-7-8-9-10-17-13-15-11-12-16(19(21)22)14-18(15)20-17/h11-12,14,17,20H,2-10,13H2,1H3,(H,21,22)/t17-/m0/s1
InChIKeyNGUQPIGUWYHNFP-KRWDZBQOSA-N
XLogP5.25
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds10
Heavy Atoms22
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500303.45
LogP ≤ 55.25
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze (2S)-2-decyl-2,3-dihydro-1H-indole-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-decyl-2,3-dihydro-1H-indole-6-carboxylic acid?
The IUPAC name of (2S)-2-decyl-2,3-dihydro-1H-indole-6-carboxylic acid (CID 70486702) is (2S)-2-decyl-2,3-dihydro-1H-indole-6-carboxylic acid.
What is the SMILES notation for (2S)-2-decyl-2,3-dihydro-1H-indole-6-carboxylic acid?
The canonical SMILES for (2S)-2-decyl-2,3-dihydro-1H-indole-6-carboxylic acid is CCCCCCCCCC[C@H]1Cc2ccc(C(=O)O)cc2N1.
What is the InChIKey of (2S)-2-decyl-2,3-dihydro-1H-indole-6-carboxylic acid?
The InChIKey is NGUQPIGUWYHNFP-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H29NO2/c1-2-3-4-5-6-7-8-9-10-17-13-15-11-12-16(19(21)22)14-18(15)20-17/h11-12,14,17,20H,2-10,13H2,1H3,(H,21,22)/t17-/m0/s1.
What are the key properties of (2S)-2-decyl-2,3-dihydro-1H-indole-6-carboxylic acid?
(2S)-2-decyl-2,3-dihydro-1H-indole-6-carboxylic acid has a molecular weight of 303.45 g/mol, XLogP of 5.25, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-decyl-2,3-dihydro-1H-indole-6-carboxylic acid is sourced from PubChem (CID 70486702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).