C19H29NO2 — CID 70486702
(2S)-2-decyl-2,3-dihydro-1H-indole-6-carboxylic acid (PubChem CID 70486702) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is (2S)-2-decyl-2,3-dihydro-1H-indole-6-carboxylic acid.
| Compound Name | (2S)-2-decyl-2,3-dihydro-1H-indole-6-carboxylic acid |
|---|---|
| PubChem CID | 70486702 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | (2S)-2-decyl-2,3-dihydro-1H-indole-6-carboxylic acid |
| SMILES | CCCCCCCCCC[C@H]1Cc2ccc(C(=O)O)cc2N1 |
| InChI | InChI=1S/C19H29NO2/c1-2-3-4-5-6-7-8-9-10-17-13-15-11-12-16(19(21)22)14-18(15)20-17/h11-12,14,17,20H,2-10,13H2,1H3,(H,21,22)/t17-/m0/s1 |
| InChIKey | NGUQPIGUWYHNFP-KRWDZBQOSA-N |
| XLogP | 5.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|