About (2R)-4-amino-2,3-dihydro-1H-indole-2-carboxylic acid
(2R)-4-amino-2,3-dihydro-1H-indole-2-carboxylic acid (PubChem CID 130664684) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is (2R)-4-amino-2,3-dihydro-1H-indole-2-carboxylic acid.
Molecular Properties
| Compound Name | (2R)-4-amino-2,3-dihydro-1H-indole-2-carboxylic acid |
| PubChem CID | 130664684 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | (2R)-4-amino-2,3-dihydro-1H-indole-2-carboxylic acid |
| SMILES | Nc1cccc2c1C[C@H](C(=O)O)N2 |
| InChI | InChI=1S/C9H10N2O2/c10-6-2-1-3-7-5(6)4-8(11-7)9(12)13/h1-3,8,11H,4,10H2,(H,12,13)/t8-/m1/s1 |
| InChIKey | ZENVZYSIIJVUGS-MRVPVSSYSA-N |
| XLogP | 0.69 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2R)-4-amino-2,3-dihydro-1H-indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-amino-2,3-dihydro-1H-indole-2-carboxylic acid?
The IUPAC name of (2R)-4-amino-2,3-dihydro-1H-indole-2-carboxylic acid (CID 130664684) is (2R)-4-amino-2,3-dihydro-1H-indole-2-carboxylic acid.
What is the SMILES notation for (2R)-4-amino-2,3-dihydro-1H-indole-2-carboxylic acid?
The canonical SMILES for (2R)-4-amino-2,3-dihydro-1H-indole-2-carboxylic acid is Nc1cccc2c1C[C@H](C(=O)O)N2.
What is the InChIKey of (2R)-4-amino-2,3-dihydro-1H-indole-2-carboxylic acid?
The InChIKey is ZENVZYSIIJVUGS-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H10N2O2/c10-6-2-1-3-7-5(6)4-8(11-7)9(12)13/h1-3,8,11H,4,10H2,(H,12,13)/t8-/m1/s1.
What are the key properties of (2R)-4-amino-2,3-dihydro-1H-indole-2-carboxylic acid?
(2R)-4-amino-2,3-dihydro-1H-indole-2-carboxylic acid has a molecular weight of 178.19 g/mol, XLogP of 0.69, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-amino-2,3-dihydro-1H-indole-2-carboxylic acid is sourced from PubChem (CID 130664684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).