C9H10N2O2 — CID 130664684
(2R)-4-amino-2,3-dihydro-1H-indole-2-carboxylic acid (PubChem CID 130664684) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is (2R)-4-amino-2,3-dihydro-1H-indole-2-carboxylic acid.
| Compound Name | (2R)-4-amino-2,3-dihydro-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 130664684 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | (2R)-4-amino-2,3-dihydro-1H-indole-2-carboxylic acid |
| SMILES | Nc1cccc2c1C[C@H](C(=O)O)N2 |
| InChI | InChI=1S/C9H10N2O2/c10-6-2-1-3-7-5(6)4-8(11-7)9(12)13/h1-3,8,11H,4,10H2,(H,12,13)/t8-/m1/s1 |
| InChIKey | ZENVZYSIIJVUGS-MRVPVSSYSA-N |
| XLogP | 0.69 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|