C9H12N2O — CID 129379706
(3R)-5-amino-1,2,3,4-tetrahydroquinolin-3-ol (PubChem CID 129379706) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is (3R)-5-amino-1,2,3,4-tetrahydroquinolin-3-ol.
| Compound Name | (3R)-5-amino-1,2,3,4-tetrahydroquinolin-3-ol |
|---|---|
| PubChem CID | 129379706 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | (3R)-5-amino-1,2,3,4-tetrahydroquinolin-3-ol |
| SMILES | Nc1cccc2c1C[C@@H](O)CN2 |
| InChI | InChI=1S/C9H12N2O/c10-8-2-1-3-9-7(8)4-6(12)5-11-9/h1-3,6,11-12H,4-5,10H2/t6-/m1/s1 |
| InChIKey | XXPMAVIICUMXOM-ZCFIWIBFSA-N |
| XLogP | 0.60 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|