C13H17N3O2 — CID 142893273
5-(4-amino-1-hydroxy-1,3-dihydroisoindol-2-yl)piperidin-2-one (PubChem CID 142893273) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 5-(4-amino-1-hydroxy-1,3-dihydroisoindol-2-yl)piperidin-2-one.
| Compound Name | 5-(4-amino-1-hydroxy-1,3-dihydroisoindol-2-yl)piperidin-2-one |
|---|---|
| PubChem CID | 142893273 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 5-(4-amino-1-hydroxy-1,3-dihydroisoindol-2-yl)piperidin-2-one |
| SMILES | Nc1cccc2c1CN(C1CCC(=O)NC1)C2O |
| InChI | InChI=1S/C13H17N3O2/c14-11-3-1-2-9-10(11)7-16(13(9)18)8-4-5-12(17)15-6-8/h1-3,8,13,18H,4-7,14H2,(H,15,17) |
| InChIKey | XANMRFJHLHOEFI-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|