C11H14N2 — CID 130654089
(3R)-5-ethenyl-1,2,3,4-tetrahydroquinolin-3-amine (PubChem CID 130654089) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is (3R)-5-ethenyl-1,2,3,4-tetrahydroquinolin-3-amine.
| Compound Name | (3R)-5-ethenyl-1,2,3,4-tetrahydroquinolin-3-amine |
|---|---|
| PubChem CID | 130654089 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | (3R)-5-ethenyl-1,2,3,4-tetrahydroquinolin-3-amine |
| SMILES | C=Cc1cccc2c1C[C@@H](N)CN2 |
| InChI | InChI=1S/C11H14N2/c1-2-8-4-3-5-11-10(8)6-9(12)7-13-11/h2-5,9,13H,1,6-7,12H2/t9-/m1/s1 |
| InChIKey | JWCWOANFXFCUIZ-SECBINFHSA-N |
| XLogP | 1.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |