C10H11NO2 — CID 86332255
(1R)-4-amino-2,3-dihydro-1H-indene-1-carboxylic acid (PubChem CID 86332255) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is (1R)-4-amino-2,3-dihydro-1H-indene-1-carboxylic acid.
| Compound Name | (1R)-4-amino-2,3-dihydro-1H-indene-1-carboxylic acid |
|---|---|
| PubChem CID | 86332255 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (1R)-4-amino-2,3-dihydro-1H-indene-1-carboxylic acid |
| SMILES | Nc1cccc2c1CC[C@H]2C(=O)O |
| InChI | InChI=1S/C10H11NO2/c11-9-3-1-2-6-7(9)4-5-8(6)10(12)13/h1-3,8H,4-5,11H2,(H,12,13)/t8-/m1/s1 |
| InChIKey | RYKWENLBNLTGQK-MRVPVSSYSA-N |
| XLogP | 1.38 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|