C18H17NO3 — CID 88775312
(4-formylphenyl) 5-amino-1,2,3,4-tetrahydronaphthalene-1-carboxylate (PubChem CID 88775312) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is (4-formylphenyl) 5-amino-1,2,3,4-tetrahydronaphthalene-1-carboxylate.
| Compound Name | (4-formylphenyl) 5-amino-1,2,3,4-tetrahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 88775312 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (4-formylphenyl) 5-amino-1,2,3,4-tetrahydronaphthalene-1-carboxylate |
| SMILES | Nc1cccc2c1CCCC2C(=O)Oc1ccc(C=O)cc1 |
| InChI | InChI=1S/C18H17NO3/c19-17-6-2-3-14-15(17)4-1-5-16(14)18(21)22-13-9-7-12(11-20)8-10-13/h2-3,6-11,16H,1,4-5,19H2 |
| InChIKey | UJOGWYOVSGLOHO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|