C18H16O5 — CID 56622794
4-(6-hydroxy-1,2,3,4-tetrahydronaphthalene-1-carbonyl)oxybenzoic acid (PubChem CID 56622794) has the molecular formula C18H16O5 and a molecular weight of 312.32 g/mol. Its IUPAC name is 4-(6-hydroxy-1,2,3,4-tetrahydronaphthalene-1-carbonyl)oxybenzoic acid.
| Compound Name | 4-(6-hydroxy-1,2,3,4-tetrahydronaphthalene-1-carbonyl)oxybenzoic acid |
|---|---|
| PubChem CID | 56622794 |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 4-(6-hydroxy-1,2,3,4-tetrahydronaphthalene-1-carbonyl)oxybenzoic acid |
| SMILES | O=C(O)c1ccc(OC(=O)C2CCCc3cc(O)ccc32)cc1 |
| InChI | InChI=1S/C18H16O5/c19-13-6-9-15-12(10-13)2-1-3-16(15)18(22)23-14-7-4-11(5-8-14)17(20)21/h4-10,16,19H,1-3H2,(H,20,21) |
| InChIKey | HYAYACFHXVQLCT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|