C38H26O10 — CID 69304710
4-(6-hydroxynaphthalene-2-carbonyl)oxybenzoic acid;4-[4-(4-hydroxyphenyl)phenoxy]carbonylbenzoic acid (PubChem CID 69304710) has the molecular formula C38H26O10 and a molecular weight of 642.62 g/mol. Its IUPAC name is 4-(6-hydroxynaphthalene-2-carbonyl)oxybenzoic acid;4-[4-(4-hydroxyphenyl)phenoxy]carbonylbenzoic acid.
| Compound Name | 4-(6-hydroxynaphthalene-2-carbonyl)oxybenzoic acid;4-[4-(4-hydroxyphenyl)phenoxy]carbonylbenzoic acid |
|---|---|
| PubChem CID | 69304710 |
| Molecular Formula | C38H26O10 |
| Molecular Weight | 642.62 g/mol |
| Exact Mass | 642.15 |
| IUPAC Name | 4-(6-hydroxynaphthalene-2-carbonyl)oxybenzoic acid;4-[4-(4-hydroxyphenyl)phenoxy]carbonylbenzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)Oc2ccc(-c3ccc(O)cc3)cc2)cc1.O=C(O)c1ccc(OC(=O)c2ccc3cc(O)ccc3c2)cc1 |
| InChI | InChI=1S/C20H14O5.C18H12O5/c21-17-9-5-13(6-10-17)14-7-11-18(12-8-14)25-20(24)16-3-1-15(2-4-16)19(22)23;19-15-6-3-12-9-14(2-1-13(12)10-15)18(22)23-16-7-4-11(5-8-16)17(20)21/h1-12,21H,(H,22,23);1-10,19H,(H,20,21) |
| InChIKey | NIOUUBOCJAYPEM-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.62 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|