C28H22O10 — CID 68923390
4-[6-(4-carboxyphenoxy)carbonylnaphthalen-2-yl]oxycarbonylbenzoic acid;ethane-1,2-diol (PubChem CID 68923390) has the molecular formula C28H22O10 and a molecular weight of 518.47 g/mol. Its IUPAC name is 4-[6-(4-carboxyphenoxy)carbonylnaphthalen-2-yl]oxycarbonylbenzoic acid;ethane-1,2-diol.
| Compound Name | 4-[6-(4-carboxyphenoxy)carbonylnaphthalen-2-yl]oxycarbonylbenzoic acid;ethane-1,2-diol |
|---|---|
| PubChem CID | 68923390 |
| Molecular Formula | C28H22O10 |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | 4-[6-(4-carboxyphenoxy)carbonylnaphthalen-2-yl]oxycarbonylbenzoic acid;ethane-1,2-diol |
| SMILES | O=C(O)c1ccc(OC(=O)c2ccc3cc(OC(=O)c4ccc(C(=O)O)cc4)ccc3c2)cc1.OCCO |
| InChI | InChI=1S/C26H16O8.C2H6O2/c27-23(28)15-1-3-17(4-2-15)25(31)34-22-12-9-18-13-20(6-5-19(18)14-22)26(32)33-21-10-7-16(8-11-21)24(29)30;3-1-2-4/h1-14H,(H,27,28)(H,29,30);3-4H,1-2H2 |
| InChIKey | JQHVYNSTAZIXTJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|