C28H24O11 — CID 90113672
ethane-1,2-diol;4-(6-hydroxynaphthalene-2-carbonyl)oxybenzoic acid;terephthalic acid (PubChem CID 90113672) has the molecular formula C28H24O11 and a molecular weight of 536.49 g/mol. Its IUPAC name is ethane-1,2-diol;4-(6-hydroxynaphthalene-2-carbonyl)oxybenzoic acid;terephthalic acid.
| Compound Name | ethane-1,2-diol;4-(6-hydroxynaphthalene-2-carbonyl)oxybenzoic acid;terephthalic acid |
|---|---|
| PubChem CID | 90113672 |
| Molecular Formula | C28H24O11 |
| Molecular Weight | 536.49 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | ethane-1,2-diol;4-(6-hydroxynaphthalene-2-carbonyl)oxybenzoic acid;terephthalic acid |
| SMILES | O=C(O)c1ccc(C(=O)O)cc1.O=C(O)c1ccc(OC(=O)c2ccc3cc(O)ccc3c2)cc1.OCCO |
| InChI | InChI=1S/C18H12O5.C8H6O4.C2H6O2/c19-15-6-3-12-9-14(2-1-13(12)10-15)18(22)23-16-7-4-11(5-8-16)17(20)21;9-7(10)5-1-2-6(4-3-5)8(11)12;3-1-2-4/h1-10,19H,(H,20,21);1-4H,(H,9,10)(H,11,12);3-4H,1-2H2 |
| InChIKey | JQEYLZZTRLQXSW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 198.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|