C17H9I3O3 — CID 146201354
(2,4,6-triiodophenyl) 6-hydroxynaphthalene-2-carboxylate (PubChem CID 146201354) has the molecular formula C17H9I3O3 and a molecular weight of 641.97 g/mol. Its IUPAC name is (2,4,6-triiodophenyl) 6-hydroxynaphthalene-2-carboxylate.
| Compound Name | (2,4,6-triiodophenyl) 6-hydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 146201354 |
| Molecular Formula | C17H9I3O3 |
| Molecular Weight | 641.97 g/mol |
| Exact Mass | 641.77 |
| IUPAC Name | (2,4,6-triiodophenyl) 6-hydroxynaphthalene-2-carboxylate |
| SMILES | O=C(Oc1c(I)cc(I)cc1I)c1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C17H9I3O3/c18-12-7-14(19)16(15(20)8-12)23-17(22)11-2-1-10-6-13(21)4-3-9(10)5-11/h1-8,21H |
| InChIKey | QVVGRZSPKVVQNH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.97 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|