About (2,4,6-triiodophenyl) 6-hydroxynaphthalene-2-carboxylate
(2,4,6-triiodophenyl) 6-hydroxynaphthalene-2-carboxylate (PubChem CID 146201354) has the molecular formula C17H9I3O3
and a molecular weight of 641.97 g/mol. Its IUPAC name is (2,4,6-triiodophenyl) 6-hydroxynaphthalene-2-carboxylate.
Molecular Properties
| Compound Name | (2,4,6-triiodophenyl) 6-hydroxynaphthalene-2-carboxylate |
| PubChem CID | 146201354 |
| Molecular Formula | C17H9I3O3 |
| Molecular Weight | 641.97 g/mol |
| Exact Mass | 641.77 |
| IUPAC Name | (2,4,6-triiodophenyl) 6-hydroxynaphthalene-2-carboxylate |
| SMILES | O=C(Oc1c(I)cc(I)cc1I)c1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C17H9I3O3/c18-12-7-14(19)16(15(20)8-12)23-17(22)11-2-1-10-6-13(21)4-3-9(10)5-11/h1-8,21H |
| InChIKey | QVVGRZSPKVVQNH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 641.97 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,4,6-triiodophenyl) 6-hydroxynaphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4,6-triiodophenyl) 6-hydroxynaphthalene-2-carboxylate?
The IUPAC name of (2,4,6-triiodophenyl) 6-hydroxynaphthalene-2-carboxylate (CID 146201354) is (2,4,6-triiodophenyl) 6-hydroxynaphthalene-2-carboxylate.
What is the SMILES notation for (2,4,6-triiodophenyl) 6-hydroxynaphthalene-2-carboxylate?
The canonical SMILES for (2,4,6-triiodophenyl) 6-hydroxynaphthalene-2-carboxylate is O=C(Oc1c(I)cc(I)cc1I)c1ccc2cc(O)ccc2c1.
What is the InChIKey of (2,4,6-triiodophenyl) 6-hydroxynaphthalene-2-carboxylate?
The InChIKey is QVVGRZSPKVVQNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9I3O3/c18-12-7-14(19)16(15(20)8-12)23-17(22)11-2-1-10-6-13(21)4-3-9(10)5-11/h1-8,21H.
What are the key properties of (2,4,6-triiodophenyl) 6-hydroxynaphthalene-2-carboxylate?
(2,4,6-triiodophenyl) 6-hydroxynaphthalene-2-carboxylate has a molecular weight of 641.97 g/mol, XLogP of 5.58, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4,6-triiodophenyl) 6-hydroxynaphthalene-2-carboxylate is sourced from PubChem (CID 146201354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).