About [(2S)-2-methylbutyl] 6-hydroxynaphthalene-2-carboxylate
[(2S)-2-methylbutyl] 6-hydroxynaphthalene-2-carboxylate (PubChem CID 54031748) has the molecular formula C16H18O3
and a molecular weight of 258.32 g/mol. Its IUPAC name is [(2S)-2-methylbutyl] 6-hydroxynaphthalene-2-carboxylate.
Molecular Properties
| Compound Name | [(2S)-2-methylbutyl] 6-hydroxynaphthalene-2-carboxylate |
| PubChem CID | 54031748 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | [(2S)-2-methylbutyl] 6-hydroxynaphthalene-2-carboxylate |
| SMILES | CC[C@H](C)COC(=O)c1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C16H18O3/c1-3-11(2)10-19-16(18)14-5-4-13-9-15(17)7-6-12(13)8-14/h4-9,11,17H,3,10H2,1-2H3/t11-/m0/s1 |
| InChIKey | LGBYIBJRPRZMHK-NSHDSACASA-N |
| XLogP | 3.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-2-methylbutyl] 6-hydroxynaphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-methylbutyl] 6-hydroxynaphthalene-2-carboxylate?
The IUPAC name of [(2S)-2-methylbutyl] 6-hydroxynaphthalene-2-carboxylate (CID 54031748) is [(2S)-2-methylbutyl] 6-hydroxynaphthalene-2-carboxylate.
What is the SMILES notation for [(2S)-2-methylbutyl] 6-hydroxynaphthalene-2-carboxylate?
The canonical SMILES for [(2S)-2-methylbutyl] 6-hydroxynaphthalene-2-carboxylate is CC[C@H](C)COC(=O)c1ccc2cc(O)ccc2c1.
What is the InChIKey of [(2S)-2-methylbutyl] 6-hydroxynaphthalene-2-carboxylate?
The InChIKey is LGBYIBJRPRZMHK-NSHDSACASA-N. The full InChI is InChI=1S/C16H18O3/c1-3-11(2)10-19-16(18)14-5-4-13-9-15(17)7-6-12(13)8-14/h4-9,11,17H,3,10H2,1-2H3/t11-/m0/s1.
What are the key properties of [(2S)-2-methylbutyl] 6-hydroxynaphthalene-2-carboxylate?
[(2S)-2-methylbutyl] 6-hydroxynaphthalene-2-carboxylate has a molecular weight of 258.32 g/mol, XLogP of 3.75, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-methylbutyl] 6-hydroxynaphthalene-2-carboxylate is sourced from PubChem (CID 54031748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).