About [(2S)-2-methylbutyl] 3-fluoro-4-hydroxybenzoate
[(2S)-2-methylbutyl] 3-fluoro-4-hydroxybenzoate (PubChem CID 54464410) has the molecular formula C12H15FO3
and a molecular weight of 226.25 g/mol. Its IUPAC name is [(2S)-2-methylbutyl] 3-fluoro-4-hydroxybenzoate.
Molecular Properties
| Compound Name | [(2S)-2-methylbutyl] 3-fluoro-4-hydroxybenzoate |
| PubChem CID | 54464410 |
| Molecular Formula | C12H15FO3 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | [(2S)-2-methylbutyl] 3-fluoro-4-hydroxybenzoate |
| SMILES | CC[C@H](C)COC(=O)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C12H15FO3/c1-3-8(2)7-16-12(15)9-4-5-11(14)10(13)6-9/h4-6,8,14H,3,7H2,1-2H3/t8-/m0/s1 |
| InChIKey | XDVUJRBVWZBSAZ-QMMMGPOBSA-N |
| XLogP | 2.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-2-methylbutyl] 3-fluoro-4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-methylbutyl] 3-fluoro-4-hydroxybenzoate?
The IUPAC name of [(2S)-2-methylbutyl] 3-fluoro-4-hydroxybenzoate (CID 54464410) is [(2S)-2-methylbutyl] 3-fluoro-4-hydroxybenzoate.
What is the SMILES notation for [(2S)-2-methylbutyl] 3-fluoro-4-hydroxybenzoate?
The canonical SMILES for [(2S)-2-methylbutyl] 3-fluoro-4-hydroxybenzoate is CC[C@H](C)COC(=O)c1ccc(O)c(F)c1.
What is the InChIKey of [(2S)-2-methylbutyl] 3-fluoro-4-hydroxybenzoate?
The InChIKey is XDVUJRBVWZBSAZ-QMMMGPOBSA-N. The full InChI is InChI=1S/C12H15FO3/c1-3-8(2)7-16-12(15)9-4-5-11(14)10(13)6-9/h4-6,8,14H,3,7H2,1-2H3/t8-/m0/s1.
What are the key properties of [(2S)-2-methylbutyl] 3-fluoro-4-hydroxybenzoate?
[(2S)-2-methylbutyl] 3-fluoro-4-hydroxybenzoate has a molecular weight of 226.25 g/mol, XLogP of 2.73, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-methylbutyl] 3-fluoro-4-hydroxybenzoate is sourced from PubChem (CID 54464410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).