C26H25FO4 — CID 170080398
[4-[4-(2-methylbutoxycarbonyl)phenyl]phenyl] 3-fluoro-4-methylbenzoate (PubChem CID 170080398) has the molecular formula C26H25FO4 and a molecular weight of 420.48 g/mol. Its IUPAC name is [4-[4-(2-methylbutoxycarbonyl)phenyl]phenyl] 3-fluoro-4-methylbenzoate.
| Compound Name | [4-[4-(2-methylbutoxycarbonyl)phenyl]phenyl] 3-fluoro-4-methylbenzoate |
|---|---|
| PubChem CID | 170080398 |
| Molecular Formula | C26H25FO4 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [4-[4-(2-methylbutoxycarbonyl)phenyl]phenyl] 3-fluoro-4-methylbenzoate |
| SMILES | CCC(C)COC(=O)c1ccc(-c2ccc(OC(=O)c3ccc(C)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C26H25FO4/c1-4-17(2)16-30-25(28)21-9-7-19(8-10-21)20-11-13-23(14-12-20)31-26(29)22-6-5-18(3)24(27)15-22/h5-15,17H,4,16H2,1-3H3 |
| InChIKey | BXBYQAYOGMDRAW-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|