C33H39FO5 — CID 139686909
[(2S)-2-methylbutyl] 2-fluoro-4-[4-(4-octan-2-yloxyphenyl)benzoyl]oxybenzoate (PubChem CID 139686909) has the molecular formula C33H39FO5 and a molecular weight of 534.67 g/mol. Its IUPAC name is [(2S)-2-methylbutyl] 2-fluoro-4-[4-(4-octan-2-yloxyphenyl)benzoyl]oxybenzoate.
| Compound Name | [(2S)-2-methylbutyl] 2-fluoro-4-[4-(4-octan-2-yloxyphenyl)benzoyl]oxybenzoate |
|---|---|
| PubChem CID | 139686909 |
| Molecular Formula | C33H39FO5 |
| Molecular Weight | 534.67 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | [(2S)-2-methylbutyl] 2-fluoro-4-[4-(4-octan-2-yloxyphenyl)benzoyl]oxybenzoate |
| SMILES | CCCCCCC(C)Oc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)OC[C@@H](C)CC)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C33H39FO5/c1-5-7-8-9-10-24(4)38-28-17-15-26(16-18-28)25-11-13-27(14-12-25)32(35)39-29-19-20-30(31(34)21-29)33(36)37-22-23(3)6-2/h11-21,23-24H,5-10,22H2,1-4H3/t23-,24?/m0/s1 |
| InChIKey | ZXZOSTMJRGFNDD-UXMRNZNESA-N |
| XLogP | 8.65 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.67 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|