C18H26O7S — CID 87698623
2,5-bis(2-methylbutoxycarbonyl)benzenesulfonic acid (PubChem CID 87698623) has the molecular formula C18H26O7S and a molecular weight of 386.47 g/mol. Its IUPAC name is 2,5-bis(2-methylbutoxycarbonyl)benzenesulfonic acid.
| Compound Name | 2,5-bis(2-methylbutoxycarbonyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 87698623 |
| Molecular Formula | C18H26O7S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2,5-bis(2-methylbutoxycarbonyl)benzenesulfonic acid |
| SMILES | CCC(C)COC(=O)c1ccc(C(=O)OCC(C)CC)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C18H26O7S/c1-5-12(3)10-24-17(19)14-7-8-15(16(9-14)26(21,22)23)18(20)25-11-13(4)6-2/h7-9,12-13H,5-6,10-11H2,1-4H3,(H,21,22,23) |
| InChIKey | VJXRKIKDJQDBKD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|